Structural search and advanced query search is temporarily unavailable. We are working to fix this issue. Thank you for your support and patience.
Metabolites
Metabolite ID | Name | Weight | Structure | Organisms |
---|---|---|---|---|
M2MDB007029 | CL(19:iso/19:0cycv8c/19:0/19:0) | 1520.178 C85H164O17P2 | ![]() | |
M2MDB007030 | CL(19:iso/19:iso/19:iso/19:iso) | 1522.194 C85H166O17P2 | ![]() | |
M2MDB007031 | Erythrose | 120.1039 C4H8O4 | ![]() | |
M2MDB007032 | 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid | 180.1574 C9H8O4 | ![]() | |
M2MDB007033 | Dihydrocurcumin | 370.3958 C21H22O6 | ![]() |